C19H17Cl2O9P — CID 86586585
[(2R,3S,5R)-3-(4-chlorobenzoyl)-3-hydroxy-5-phosphonooxyoxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 86586585) has the molecular formula C19H17Cl2O9P and a molecular weight of 491.22 g/mol. Its IUPAC name is [(2R,3S,5R)-3-(4-chlorobenzoyl)-3-hydroxy-5-phosphonooxyoxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2R,3S,5R)-3-(4-chlorobenzoyl)-3-hydroxy-5-phosphonooxyoxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 86586585 |
| Molecular Formula | C19H17Cl2O9P |
| Molecular Weight | 491.22 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | [(2R,3S,5R)-3-(4-chlorobenzoyl)-3-hydroxy-5-phosphonooxyoxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | O=C(OC[C@H]1O[C@H](OP(=O)(O)O)C[C@@]1(O)C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2O9P/c20-13-5-1-11(2-6-13)17(22)19(24)9-16(30-31(25,26)27)29-15(19)10-28-18(23)12-3-7-14(21)8-4-12/h1-8,15-16,24H,9-10H2,(H2,25,26,27)/t15-,16-,19+/m1/s1 |
| InChIKey | CZGGSYSVFGVGCX-MDZRGWNJSA-N |
| XLogP | 2.99 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|