C15H16O6 — CID 10637363
[(2R,3S,4R)-3-ethynyl-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl benzoate (PubChem CID 10637363) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is [(2R,3S,4R)-3-ethynyl-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R)-3-ethynyl-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10637363 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [(2R,3S,4R)-3-ethynyl-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl benzoate |
| SMILES | C#C[C@@]1(O)[C@@H](COC(=O)c2ccccc2)OC(OC)[C@@H]1O |
| InChI | InChI=1S/C15H16O6/c1-3-15(18)11(21-14(19-2)12(15)16)9-20-13(17)10-7-5-4-6-8-10/h1,4-8,11-12,14,16,18H,9H2,2H3/t11-,12+,14?,15-/m1/s1 |
| InChIKey | WHRIHEKLSITXEV-BNGAQMRFSA-N |
| XLogP | -0.06 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|