C15H16O4 — CID 54574161
prop-2-ynyl 4-[(3,3-dimethyloxiran-2-yl)methoxy]benzoate (PubChem CID 54574161) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is prop-2-ynyl 4-[(3,3-dimethyloxiran-2-yl)methoxy]benzoate.
| Compound Name | prop-2-ynyl 4-[(3,3-dimethyloxiran-2-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 54574161 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | prop-2-ynyl 4-[(3,3-dimethyloxiran-2-yl)methoxy]benzoate |
| SMILES | C#CCOC(=O)c1ccc(OCC2OC2(C)C)cc1 |
| InChI | InChI=1S/C15H16O4/c1-4-9-17-14(16)11-5-7-12(8-6-11)18-10-13-15(2,3)19-13/h1,5-8,13H,9-10H2,2-3H3 |
| InChIKey | ZZJOEGWALXQTRU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|