C21H26N4O — CID 118490884
7-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5-octa-1,7-diynylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 118490884) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 7-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5-octa-1,7-diynylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5-octa-1,7-diynylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118490884 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-[(2R,4R,5R)-5-ethyl-4-methyloxolan-2-yl]-5-octa-1,7-diynylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C#CCCCCC#Cc1cn([C@H]2C[C@@H](C)[C@@H](CC)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C21H26N4O/c1-4-6-7-8-9-10-11-16-13-25(18-12-15(3)17(5-2)26-18)21-19(16)20(22)23-14-24-21/h1,13-15,17-18H,5-9,12H2,2-3H3,(H2,22,23,24)/t15-,17-,18-/m1/s1 |
| InChIKey | SHPLJWVHLOSRKS-KBAYOESNSA-N |
| XLogP | 3.89 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|