C22H37N5O5Si — CID 153295276
2-[1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrazolo[3,4-d]pyrimidin-3-yl]propan-2-ol (PubChem CID 153295276) has the molecular formula C22H37N5O5Si and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-[1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrazolo[3,4-d]pyrimidin-3-yl]propan-2-ol.
| Compound Name | 2-[1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrazolo[3,4-d]pyrimidin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 153295276 |
| Molecular Formula | C22H37N5O5Si |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-[1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrazolo[3,4-d]pyrimidin-3-yl]propan-2-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]2n1nc(C(C)(C)O)c2c(N)ncnc21 |
| InChI | InChI=1S/C22H37N5O5Si/c1-20(2,3)33(8,9)29-10-12-14-15(32-22(6,7)31-14)19(30-12)27-18-13(17(23)24-11-25-18)16(26-27)21(4,5)28/h11-12,14-15,19,28H,10H2,1-9H3,(H2,23,24,25)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | VCOOFROIWJVBIO-QEPJRFBGSA-N |
| XLogP | 3.08 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|