C23H42FN5O3SSi2 — CID 153295241
1-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 153295241) has the molecular formula C23H42FN5O3SSi2 and a molecular weight of 543.86 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 153295241 |
| Molecular Formula | C23H42FN5O3SSi2 |
| Molecular Weight | 543.86 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[(2R,3S,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]-3-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CSc1nn([C@@H]2O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2F)c2ncnc(N)c12 |
| InChI | InChI=1S/C23H42FN5O3SSi2/c1-22(2,3)34(8,9)30-12-14-17(32-35(10,11)23(4,5)6)16(24)21(31-14)29-19-15(20(28-29)33-7)18(25)26-13-27-19/h13-14,16-17,21H,12H2,1-11H3,(H2,25,26,27)/t14-,16-,17+,21+/m0/s1 |
| InChIKey | WCIKFWJCLXSXBZ-JKXYVKTPSA-N |
| XLogP | 5.78 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.86 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|