C23H22Cl3NO6S — CID 88544544
[(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 88544544) has the molecular formula C23H22Cl3NO6S and a molecular weight of 546.86 g/mol. Its IUPAC name is [(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88544544 |
| Molecular Formula | C23H22Cl3NO6S |
| Molecular Weight | 546.86 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | [(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](n3c(Cl)cc4cc(Cl)c(Cl)cc43)C3OC(C)(C)OC32)cc1 |
| InChI | InChI=1S/C23H22Cl3NO6S/c1-12-4-6-14(7-5-12)34(28,29)30-11-18-20-21(33-23(2,3)32-20)22(31-18)27-17-10-16(25)15(24)8-13(17)9-19(27)26/h4-10,18,20-22H,11H2,1-3H3/t18-,20?,21?,22-/m1/s1 |
| InChIKey | AVGXPXNGADAZSO-DZVQBONVSA-N |
| XLogP | 5.73 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.86 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|