C37H40O5Si — CID 100924495
[(Z)-2-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethenyl]-dimethyl-phenylsilane (PubChem CID 100924495) has the molecular formula C37H40O5Si and a molecular weight of 592.81 g/mol. Its IUPAC name is [(Z)-2-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethenyl]-dimethyl-phenylsilane.
| Compound Name | [(Z)-2-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethenyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 100924495 |
| Molecular Formula | C37H40O5Si |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | [(Z)-2-[[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethenyl]-dimethyl-phenylsilane |
| SMILES | CC1(C)O[C@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H](O/C=C\[Si](C)(C)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C37H40O5Si/c1-36(2)41-34-33(38-25-26-43(3,4)31-23-15-8-16-24-31)32(40-35(34)42-36)27-39-37(28-17-9-5-10-18-28,29-19-11-6-12-20-29)30-21-13-7-14-22-30/h5-26,32-35H,27H2,1-4H3/b26-25-/t32-,33+,34-,35-/m1/s1 |
| InChIKey | JOMSHYHHQLOFGN-LOAWBJJLSA-N |
| XLogP | 6.93 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|