C33H38O4 — CID 53247792
[(E,5R,6S)-6-methyl-5-(3-oxopropyl)-8-trityloxyoct-3-en-2-yl] acetate (PubChem CID 53247792) has the molecular formula C33H38O4 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(E,5R,6S)-6-methyl-5-(3-oxopropyl)-8-trityloxyoct-3-en-2-yl] acetate.
| Compound Name | [(E,5R,6S)-6-methyl-5-(3-oxopropyl)-8-trityloxyoct-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 53247792 |
| Molecular Formula | C33H38O4 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(E,5R,6S)-6-methyl-5-(3-oxopropyl)-8-trityloxyoct-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(C)/C=C/[C@H](CCC=O)[C@@H](C)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38O4/c1-26(29(14-13-24-34)22-21-27(2)37-28(3)35)23-25-36-33(30-15-7-4-8-16-30,31-17-9-5-10-18-31)32-19-11-6-12-20-32/h4-12,15-22,24,26-27,29H,13-14,23,25H2,1-3H3/b22-21+/t26-,27?,29-/m0/s1 |
| InChIKey | RPODJCXRMQPEJK-SEEQLOPTSA-N |
| XLogP | 7.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|