C27H34NO6P — CID 67989505
2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethoxy]ethyl propan-2-yl hydrogen phosphate (PubChem CID 67989505) has the molecular formula C27H34NO6P and a molecular weight of 499.54 g/mol. Its IUPAC name is 2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethoxy]ethyl propan-2-yl hydrogen phosphate.
| Compound Name | 2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethoxy]ethyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 67989505 |
| Molecular Formula | C27H34NO6P |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethoxy]ethyl propan-2-yl hydrogen phosphate |
| SMILES | COc1ccc(C(NCCOCCOP(=O)(O)OC(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H34NO6P/c1-22(2)34-35(29,30)33-21-20-32-19-18-28-27(23-10-6-4-7-11-23,24-12-8-5-9-13-24)25-14-16-26(31-3)17-15-25/h4-17,22,28H,18-21H2,1-3H3,(H,29,30) |
| InChIKey | CDXJJQMKJGVPMJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|