C25H32N8O10 — CID 136792098
2-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid (PubChem CID 136792098) has the molecular formula C25H32N8O10 and a molecular weight of 604.58 g/mol. Its IUPAC name is 2-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 136792098 |
| Molecular Formula | C25H32N8O10 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 2-[2-[(4,5-dimethoxy-2-nitrophenyl)methoxycarbonylamino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
| SMILES | COc1cc(COC(=O)NCCN(CC(=O)O)C(=O)Cn2cnc3c(=O)[nH]c(NCC(C)C)nc32)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H32N8O10/c1-14(2)9-27-24-29-22-21(23(37)30-24)28-13-32(22)10-19(34)31(11-20(35)36)6-5-26-25(38)43-12-15-7-17(41-3)18(42-4)8-16(15)33(39)40/h7-8,13-14H,5-6,9-12H2,1-4H3,(H,26,38)(H,35,36)(H2,27,29,30,37) |
| InChIKey | QJTCWQSWMLISRQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 233.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|