C20H17F2N3O7 — CID 55460305
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate (PubChem CID 55460305) has the molecular formula C20H17F2N3O7 and a molecular weight of 449.37 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 55460305 |
| Molecular Formula | C20H17F2N3O7 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(8-methyl-4-oxoquinazolin-3-yl)acetate |
| SMILES | COc1cc(COC(=O)Cn2cnc3c(C)cccc3c2=O)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C20H17F2N3O7/c1-11-4-3-5-13-18(11)23-10-24(19(13)27)8-17(26)31-9-12-6-15(30-2)16(32-20(21)22)7-14(12)25(28)29/h3-7,10,20H,8-9H2,1-2H3 |
| InChIKey | WQBMUBDYLNAOPW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 122.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|