C20H18F2N2O8 — CID 55459245
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate (PubChem CID 55459245) has the molecular formula C20H18F2N2O8 and a molecular weight of 452.37 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate |
|---|---|
| PubChem CID | 55459245 |
| Molecular Formula | C20H18F2N2O8 |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate |
| SMILES | COc1cc(COC(=O)CCCn2c(=O)oc3ccccc32)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C20H18F2N2O8/c1-29-16-9-12(14(24(27)28)10-17(16)31-19(21)22)11-30-18(25)7-4-8-23-13-5-2-3-6-15(13)32-20(23)26/h2-3,5-6,9-10,19H,4,7-8,11H2,1H3 |
| InChIKey | VLJSRDRRUWOBFW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 123.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|