C18H18F2N2O8 — CID 55458548
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(furan-2-carbonylamino)butanoate (PubChem CID 55458548) has the molecular formula C18H18F2N2O8 and a molecular weight of 428.34 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(furan-2-carbonylamino)butanoate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(furan-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 55458548 |
| Molecular Formula | C18H18F2N2O8 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-(furan-2-carbonylamino)butanoate |
| SMILES | COc1cc(COC(=O)CCCNC(=O)c2ccco2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O8/c1-27-14-8-11(12(22(25)26)9-15(14)30-18(19)20)10-29-16(23)5-2-6-21-17(24)13-4-3-7-28-13/h3-4,7-9,18H,2,5-6,10H2,1H3,(H,21,24) |
| InChIKey | WIRJAHCMFSRQOX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|