C19H16F3NO6 — CID 55473263
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(4-fluorophenyl)cyclopropane-1-carboxylate (PubChem CID 55473263) has the molecular formula C19H16F3NO6 and a molecular weight of 411.33 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(4-fluorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(4-fluorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55473263 |
| Molecular Formula | C19H16F3NO6 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-(4-fluorophenyl)cyclopropane-1-carboxylate |
| SMILES | COc1cc(COC(=O)C2CC2c2ccc(F)cc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H16F3NO6/c1-27-16-6-11(15(23(25)26)8-17(16)29-19(21)22)9-28-18(24)14-7-13(14)10-2-4-12(20)5-3-10/h2-6,8,13-14,19H,7,9H2,1H3 |
| InChIKey | XZAVDBQYKVKBOE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|