C18H17ClF2N2O8S — CID 55459171
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-chloro-3-(dimethylsulfamoyl)benzoate (PubChem CID 55459171) has the molecular formula C18H17ClF2N2O8S and a molecular weight of 494.86 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-chloro-3-(dimethylsulfamoyl)benzoate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-chloro-3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55459171 |
| Molecular Formula | C18H17ClF2N2O8S |
| Molecular Weight | 494.86 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 4-chloro-3-(dimethylsulfamoyl)benzoate |
| SMILES | COc1cc(COC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H17ClF2N2O8S/c1-22(2)32(27,28)16-7-10(4-5-12(16)19)17(24)30-9-11-6-14(29-3)15(31-18(20)21)8-13(11)23(25)26/h4-8,18H,9H2,1-3H3 |
| InChIKey | QLYUPAVAKMYQBK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|