C17H15ClN2O5S — CID 8631211
(2-cyanophenyl)methyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8631211) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | (2-cyanophenyl)methyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8631211 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2-cyanophenyl)methyl 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)OCc2ccccc2C#N)ccc1Cl |
| InChI | InChI=1S/C17H15ClN2O5S/c1-20(24-2)26(22,23)16-9-12(7-8-15(16)18)17(21)25-11-14-6-4-3-5-13(14)10-19/h3-9H,11H2,1-2H3 |
| InChIKey | LHUKYQUOXBQMPV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|