C19H21ClN2O7S — CID 27738377
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 27738377) has the molecular formula C19H21ClN2O7S and a molecular weight of 456.90 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 27738377 |
| Molecular Formula | C19H21ClN2O7S |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)OC)c1 |
| InChI | InChI=1S/C19H21ClN2O7S/c1-22(28-3)30(25,26)17-10-13(8-9-15(17)20)19(24)29-12-18(23)21-11-14-6-4-5-7-16(14)27-2/h4-10H,11-12H2,1-3H3,(H,21,23) |
| InChIKey | YJSWTQWWDUUMMX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|