C19H20ClNO8S — CID 27738707
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 27738707) has the molecular formula C19H20ClNO8S and a molecular weight of 457.89 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 27738707 |
| Molecular Formula | C19H20ClNO8S |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)OC)c2)c1 |
| InChI | InChI=1S/C19H20ClNO8S/c1-21(28-4)30(24,25)18-9-12(5-7-15(18)20)19(23)29-11-16(22)14-10-13(26-2)6-8-17(14)27-3/h5-10H,11H2,1-4H3 |
| InChIKey | OQNBQKCDANDDMY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|