C16H23ClN2O6S — CID 8631224
[2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8631224) has the molecular formula C16H23ClN2O6S and a molecular weight of 406.89 g/mol. Its IUPAC name is [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8631224 |
| Molecular Formula | C16H23ClN2O6S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CCC(C)(C)NC(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)OC)c1 |
| InChI | InChI=1S/C16H23ClN2O6S/c1-6-16(2,3)18-14(20)10-25-15(21)11-7-8-12(17)13(9-11)26(22,23)19(4)24-5/h7-9H,6,10H2,1-5H3,(H,18,20) |
| InChIKey | HENGVHGLHLDXRJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|