C17H16Cl2N2O6S — CID 27738423
[2-(4-chloroanilino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 27738423) has the molecular formula C17H16Cl2N2O6S and a molecular weight of 447.30 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 27738423 |
| Molecular Formula | C17H16Cl2N2O6S |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O6S/c1-21(26-2)28(24,25)15-9-11(3-8-14(15)19)17(23)27-10-16(22)20-13-6-4-12(18)5-7-13/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | BARBNCLHWAYOHA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|