C17H27ClN2O4S — CID 55538385
4-chloro-3-[methoxy(methyl)sulfamoyl]-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 55538385) has the molecular formula C17H27ClN2O4S and a molecular weight of 390.93 g/mol. Its IUPAC name is 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 55538385 |
| Molecular Formula | C17H27ClN2O4S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)NC(C)(C)CC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C17H27ClN2O4S/c1-16(2,3)11-17(4,5)19-15(21)12-8-9-13(18)14(10-12)25(22,23)20(6)24-7/h8-10H,11H2,1-7H3,(H,19,21) |
| InChIKey | MVSDHCYPOPAHFF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|