C14H19ClN2O6S — CID 8722333
[(2S)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8722333) has the molecular formula C14H19ClN2O6S and a molecular weight of 378.83 g/mol. Its IUPAC name is [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8722333 |
| Molecular Formula | C14H19ClN2O6S |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CCNC(=O)[C@H](C)OC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)OC)c1 |
| InChI | InChI=1S/C14H19ClN2O6S/c1-5-16-13(18)9(2)23-14(19)10-6-7-11(15)12(8-10)24(20,21)17(3)22-4/h6-9H,5H2,1-4H3,(H,16,18)/t9-/m0/s1 |
| InChIKey | FMPAUPGHGJNUJK-VIFPVBQESA-N |
| XLogP | 1.20 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|