C16H22ClN3O7S — CID 46684950
[1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 46684950) has the molecular formula C16H22ClN3O7S and a molecular weight of 435.89 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46684950 |
| Molecular Formula | C16H22ClN3O7S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)OC(C)C(=O)NC(=O)NC(C)C)ccc1Cl |
| InChI | InChI=1S/C16H22ClN3O7S/c1-9(2)18-16(23)19-14(21)10(3)27-15(22)11-6-7-12(17)13(8-11)28(24,25)20(4)26-5/h6-10H,1-5H3,(H2,18,19,21,23) |
| InChIKey | INLKNFIJVNZUPT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|