C16H15Cl2NO4 — CID 55369171
(2,4-dichlorophenyl)methyl 4-(furan-2-carbonylamino)butanoate (PubChem CID 55369171) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.20 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 4-(furan-2-carbonylamino)butanoate.
| Compound Name | (2,4-dichlorophenyl)methyl 4-(furan-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 55369171 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 4-(furan-2-carbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)c1ccco1)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO4/c17-12-6-5-11(13(18)9-12)10-23-15(20)4-1-7-19-16(21)14-3-2-8-22-14/h2-3,5-6,8-9H,1,4,7,10H2,(H,19,21) |
| InChIKey | UBQMZXSXZONNIO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|