C21H17NO7 — CID 7791072
(7-hydroxy-2-oxochromen-4-yl)methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate (PubChem CID 7791072) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate |
|---|---|
| PubChem CID | 7791072 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 4-(2-oxo-1,3-benzoxazol-3-yl)butanoate |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C21H17NO7/c23-14-7-8-15-13(10-20(25)28-18(15)11-14)12-27-19(24)6-3-9-22-16-4-1-2-5-17(16)29-21(22)26/h1-2,4-5,7-8,10-11,23H,3,6,9,12H2 |
| InChIKey | YEVYXIYZVWKDFM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|