C22H19NO6 — CID 8727060
(7-ethyl-2-oxochromen-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate (PubChem CID 8727060) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 8727060 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 3-(2-oxo-1,3-benzoxazol-3-yl)propanoate |
| SMILES | CCc1ccc2c(COC(=O)CCn3c(=O)oc4ccccc43)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H19NO6/c1-2-14-7-8-16-15(12-21(25)28-19(16)11-14)13-27-20(24)9-10-23-17-5-3-4-6-18(17)29-22(23)26/h3-8,11-12H,2,9-10,13H2,1H3 |
| InChIKey | SXOFYKDSPVZEBE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|