C24H21NO6 — CID 55375258
(7-ethyl-2-oxochromen-4-yl)methyl 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55375258) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55375258 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCc1ccc2c(COC(=O)CCN3C(=O)c4ccc(C)cc4C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H21NO6/c1-3-15-5-7-17-16(12-22(27)31-20(17)11-15)13-30-21(26)8-9-25-23(28)18-6-4-14(2)10-19(18)24(25)29/h4-7,10-12H,3,8-9,13H2,1-2H3 |
| InChIKey | AKEOSOOTPYMIOS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|