C22H21NO6 — CID 7350847
(7-methyl-2-oxochromen-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 7350847) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7350847 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | Cc1ccc2c(COC(=O)CCN3C(=O)[C@H]4CC=CC[C@@H]4C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO6/c1-13-6-7-15-14(11-20(25)29-18(15)10-13)12-28-19(24)8-9-23-21(26)16-4-2-3-5-17(16)22(23)27/h2-3,6-7,10-11,16-17H,4-5,8-9,12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | VROWZSHLCHUYBC-IRXDYDNUSA-N |
| XLogP | 2.49 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|