C21H19NO6 — CID 2534700
(7-methyl-2-oxochromen-4-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 2534700) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 2534700 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | Cc1ccc2c(COC(=O)CN3C(=O)[C@H]4CC=CC[C@H]4C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H19NO6/c1-12-6-7-14-13(9-18(23)28-17(14)8-12)11-27-19(24)10-22-20(25)15-4-2-3-5-16(15)21(22)26/h2-3,6-9,15-16H,4-5,10-11H2,1H3/t15-,16+ |
| InChIKey | VICCTBUQTNCRLL-IYBDPMFKSA-N |
| XLogP | 2.10 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|