C23H26N2O6 — CID 47093946
(7-methyl-2-oxochromen-4-yl)methyl 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 47093946) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 47093946 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)OCc1cc(=O)oc3cc(C)ccc13)C2=O |
| InChI | InChI=1S/C23H26N2O6/c1-3-15-6-8-23(9-7-15)21(28)25(22(29)24-23)12-20(27)30-13-16-11-19(26)31-18-10-14(2)4-5-17(16)18/h4-5,10-11,15H,3,6-9,12-13H2,1-2H3,(H,24,29) |
| InChIKey | VAVZHSWLECAIHU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|