C22H19NO4 — CID 7960202
(7-ethyl-2-oxochromen-4-yl)methyl 2-(1H-indol-3-yl)acetate (PubChem CID 7960202) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960202 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 2-(1H-indol-3-yl)acetate |
| SMILES | CCc1ccc2c(COC(=O)Cc3c[nH]c4ccccc34)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H19NO4/c1-2-14-7-8-18-16(11-22(25)27-20(18)9-14)13-26-21(24)10-15-12-23-19-6-4-3-5-17(15)19/h3-9,11-12,23H,2,10,13H2,1H3 |
| InChIKey | CRPOAJXRDURYJJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|