About 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid
3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid (PubChem CID 158207291) has the molecular formula C18H27N3O9
and a molecular weight of 429.43 g/mol. Its IUPAC name is 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid.
Molecular Properties
| Compound Name | 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid |
| PubChem CID | 158207291 |
| Molecular Formula | C18H27N3O9 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid |
| SMILES | CC(N)CC(=O)O.COc1cc(COC(=O)NC(C)CC(=O)O)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H18N2O7.C4H9NO2/c1-8-4-11(16(20)21)10(6-12(8)22-3)7-23-14(19)15-9(2)5-13(17)18;1-3(5)2-4(6)7/h4,6,9H,5,7H2,1-3H3,(H,15,19)(H,17,18);3H,2,5H2,1H3,(H,6,7) |
| InChIKey | GBQMOQJWZUFFLL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 191.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid?
The IUPAC name of 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid (CID 158207291) is 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid.
What is the SMILES notation for 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid?
The canonical SMILES for 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid is CC(N)CC(=O)O.COc1cc(COC(=O)NC(C)CC(=O)O)c([N+](=O)[O-])cc1C.
What is the InChIKey of 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid?
The InChIKey is GBQMOQJWZUFFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O7.C4H9NO2/c1-8-4-11(16(20)21)10(6-12(8)22-3)7-23-14(19)15-9(2)5-13(17)18;1-3(5)2-4(6)7/h4,6,9H,5,7H2,1-3H3,(H,15,19)(H,17,18);3H,2,5H2,1H3,(H,6,7).
What are the key properties of 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid?
3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid has a molecular weight of 429.43 g/mol, XLogP of 1.81, 9 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobutanoic acid;3-[(5-methoxy-4-methyl-2-nitrophenyl)methoxycarbonylamino]butanoic acid is sourced from PubChem (CID 158207291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).