C7H7N5OS — CID 137201377
9-ethyl-2-thionitroso-1H-purin-6-one (PubChem CID 137201377) has the molecular formula C7H7N5OS and a molecular weight of 209.23 g/mol. Its IUPAC name is 9-ethyl-2-thionitroso-1H-purin-6-one.
| Compound Name | 9-ethyl-2-thionitroso-1H-purin-6-one |
|---|---|
| PubChem CID | 137201377 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 9-ethyl-2-thionitroso-1H-purin-6-one |
| SMILES | CCn1cnc2c(=O)[nH]c(N=S)nc21 |
| InChI | InChI=1S/C7H7N5OS/c1-2-12-3-8-4-5(12)9-7(11-14)10-6(4)13/h3H,2H2,1H3,(H,9,10,13) |
| InChIKey | HIKBHPZJUCGDAO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |