C27H36N7O6P — CID 20598654
[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-methoxyanilino)-4-methylpentanoate (PubChem CID 20598654) has the molecular formula C27H36N7O6P and a molecular weight of 585.60 g/mol. Its IUPAC name is [[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-methoxyanilino)-4-methylpentanoate.
| Compound Name | [[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-methoxyanilino)-4-methylpentanoate |
|---|---|
| PubChem CID | 20598654 |
| Molecular Formula | C27H36N7O6P |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | [[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-methoxyanilino)-4-methylpentanoate |
| SMILES | CON(c1ccccc1)[C@@H](CC(C)C)C(=O)OP(=O)(O)OC[C@@H]1C=C[C@H](n2cnc3c(NC4CC4)nc(N)nc32)C1 |
| InChI | InChI=1S/C27H36N7O6P/c1-17(2)13-22(34(38-3)20-7-5-4-6-8-20)26(35)40-41(36,37)39-15-18-9-12-21(14-18)33-16-29-23-24(30-19-10-11-19)31-27(28)32-25(23)33/h4-9,12,16-19,21-22H,10-11,13-15H2,1-3H3,(H,36,37)(H3,28,30,31,32)/t18-,21+,22+/m1/s1 |
| InChIKey | FRDQUUYKZAHSIU-COPCDDAFSA-N |
| XLogP | 4.24 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|