C22H27N6O5P — CID 154193364
[(1R,4S)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-(N-methoxyanilino)propanoyl]phosphonamidic acid (PubChem CID 154193364) has the molecular formula C22H27N6O5P and a molecular weight of 486.47 g/mol. Its IUPAC name is [(1R,4S)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-(N-methoxyanilino)propanoyl]phosphonamidic acid.
| Compound Name | [(1R,4S)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-(N-methoxyanilino)propanoyl]phosphonamidic acid |
|---|---|
| PubChem CID | 154193364 |
| Molecular Formula | C22H27N6O5P |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | [(1R,4S)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-(N-methoxyanilino)propanoyl]phosphonamidic acid |
| SMILES | CON(c1ccccc1)[C@@H](C)C(=O)NP(=O)(O)OC[C@H]1C=C[C@@H](n2ccc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C22H27N6O5P/c1-15(28(32-2)17-6-4-3-5-7-17)22(29)26-34(30,31)33-13-16-8-9-18(12-16)27-11-10-19-20(23)24-14-25-21(19)27/h3-11,14-16,18H,12-13H2,1-2H3,(H2,23,24,25)(H2,26,29,30,31)/t15-,16-,18+/m0/s1 |
| InChIKey | JQIFMHXEZGBTEY-XYJFISCASA-N |
| XLogP | 2.82 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|