C31H38N7O5P — CID 140508039
[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]-3-phenylpropanoyl]phosphonamidic acid (PubChem CID 140508039) has the molecular formula C31H38N7O5P and a molecular weight of 619.66 g/mol. Its IUPAC name is [(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]-3-phenylpropanoyl]phosphonamidic acid.
| Compound Name | [(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]-3-phenylpropanoyl]phosphonamidic acid |
|---|---|
| PubChem CID | 140508039 |
| Molecular Formula | C31H38N7O5P |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | [(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-2-[N-(2,2-dimethylpropoxy)anilino]-3-phenylpropanoyl]phosphonamidic acid |
| SMILES | CC(C)(C)CON(c1ccccc1)[C@@H](Cc1ccccc1)C(=O)NP(=O)(O)OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C31H38N7O5P/c1-31(2,3)19-42-38(24-12-8-5-9-13-24)26(17-22-10-6-4-7-11-22)30(39)36-44(40,41)43-18-23-14-15-25(16-23)37-21-35-27-28(32)33-20-34-29(27)37/h4-15,20-21,23,25-26H,16-19H2,1-3H3,(H2,32,33,34)(H2,36,39,40,41)/t23-,25+,26-/m0/s1 |
| InChIKey | YLEHYAMVJCXJRZ-DMDYGQEQSA-N |
| XLogP | 4.85 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|