C20H24N7O4P — CID 87923792
[amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 87923792) has the molecular formula C20H24N7O4P and a molecular weight of 457.43 g/mol. Its IUPAC name is [amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 87923792 |
| Molecular Formula | C20H24N7O4P |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C=C[C@H](COP(N)(=O)OC(=O)[C@@H](N)Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N7O4P/c21-16(9-13-4-2-1-3-5-13)20(28)31-32(23,29)30-10-14-6-7-15(8-14)27-12-26-17-18(22)24-11-25-19(17)27/h1-7,11-12,14-16H,8-10,21H2,(H2,23,29)(H2,22,24,25)/t14-,15+,16-,32?/m0/s1 |
| InChIKey | AAJSDSSVISIFDD-OOMOZZFISA-N |
| XLogP | 1.72 |
| TPSA | 174.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|