C22H27N6O5P — CID 513203
methyl 2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 513203) has the molecular formula C22H27N6O5P and a molecular weight of 486.47 g/mol. Its IUPAC name is methyl 2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 513203 |
| Molecular Formula | C22H27N6O5P |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | methyl 2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NP(=O)(OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C22H27N6O5P/c1-22(2,21(29)31-3)27-34(30,33-17-7-5-4-6-8-17)32-12-15-9-10-16(11-15)28-14-26-18-19(23)24-13-25-20(18)28/h4-10,13-16H,11-12H2,1-3H3,(H,27,30)(H2,23,24,25)/t15-,16+,34?/m0/s1 |
| InChIKey | AWYVUAVSFSFVLE-AJIGYJTRSA-N |
| XLogP | 3.27 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|