C14H20N7O9P — CID 67201596
(3S)-3-amino-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-oxobutanoic acid (PubChem CID 67201596) has the molecular formula C14H20N7O9P and a molecular weight of 461.33 g/mol. Its IUPAC name is (3S)-3-amino-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67201596 |
| Molecular Formula | C14H20N7O9P |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (3S)-3-amino-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-oxobutanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)NC(=O)[C@@H](N)CC(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N7O9P/c15-5(1-7(22)23)13(26)20-31(27,28)29-2-6-9(24)10(25)14(30-6)21-4-19-8-11(16)17-3-18-12(8)21/h3-6,9-10,14,24-25H,1-2,15H2,(H,22,23)(H2,16,17,18)(H2,20,26,27,28)/t5-,6+,9+,10+,14+/m0/s1 |
| InChIKey | XSMMHBQMYIIGCK-UFIIOMENSA-N |
| XLogP | -2.94 |
| TPSA | 258.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|