C12H17N6O8P — CID 101046655
2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]acetic acid (PubChem CID 101046655) has the molecular formula C12H17N6O8P and a molecular weight of 404.28 g/mol. Its IUPAC name is 2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]acetic acid.
| Compound Name | 2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]acetic acid |
|---|---|
| PubChem CID | 101046655 |
| Molecular Formula | C12H17N6O8P |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]acetic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)NCC(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17N6O8P/c13-10-7-11(15-3-14-10)18(4-16-7)12-9(22)8(21)5(26-12)2-25-27(23,24)17-1-6(19)20/h3-5,8-9,12,21-22H,1-2H2,(H,19,20)(H2,13,14,15)(H2,17,23,24)/t5-,8-,9-,12-/m1/s1 |
| InChIKey | OFENVOUOJQRLCP-JJNLEZRASA-N |
| XLogP | -2.18 |
| TPSA | 215.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|