C12H14N4O5P- — CID 136790291
hydroxy-[[(1S,4R)-2-methyl-4-(6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl]-dioxidophosphanium (PubChem CID 136790291) has the molecular formula C12H14N4O5P- and a molecular weight of 325.24 g/mol. Its IUPAC name is hydroxy-[[(1S,4R)-2-methyl-4-(6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl]-dioxidophosphanium.
| Compound Name | hydroxy-[[(1S,4R)-2-methyl-4-(6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl]-dioxidophosphanium |
|---|---|
| PubChem CID | 136790291 |
| Molecular Formula | C12H14N4O5P- |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | hydroxy-[[(1S,4R)-2-methyl-4-(6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl]-dioxidophosphanium |
| SMILES | CC1=C[C@H](n2cnc3c(=O)[nH]cnc32)C[C@@H]1OC[P+]([O-])([O-])O |
| InChI | InChI=1S/C12H15N4O5P/c1-7-2-8(3-9(7)21-6-22(18,19)20)16-5-15-10-11(16)13-4-14-12(10)17/h2,4-5,8-9H,3,6H2,1H3,(H,13,14,17)(H2,18,19,20)/p-1/t8-,9-/m0/s1 |
| InChIKey | WYROIBOECCHEJD-IUCAKERBSA-M |
| XLogP | -1.17 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|