C12H15N5O5P- — CID 136790293
[(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-methylcyclopent-2-en-1-yl]oxymethyl-hydroxy-dioxidophosphanium (PubChem CID 136790293) has the molecular formula C12H15N5O5P- and a molecular weight of 340.26 g/mol. Its IUPAC name is [(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-methylcyclopent-2-en-1-yl]oxymethyl-hydroxy-dioxidophosphanium.
| Compound Name | [(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-methylcyclopent-2-en-1-yl]oxymethyl-hydroxy-dioxidophosphanium |
|---|---|
| PubChem CID | 136790293 |
| Molecular Formula | C12H15N5O5P- |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-methylcyclopent-2-en-1-yl]oxymethyl-hydroxy-dioxidophosphanium |
| SMILES | CC1=C[C@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@@H]1OC[P+]([O-])([O-])O |
| InChI | InChI=1S/C12H16N5O5P/c1-6-2-7(3-8(6)22-5-23(19,20)21)17-4-14-9-10(17)15-12(13)16-11(9)18/h2,4,7-8H,3,5H2,1H3,(H2,19,20,21)(H3,13,15,16,18)/p-1/t7-,8-/m0/s1 |
| InChIKey | RGXPRTJHWQCRPC-YUMQZZPRSA-M |
| XLogP | -1.59 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|