C9H11N5O5P- — CID 136784290
[(2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]-hydroxy-dioxidophosphanium (PubChem CID 136784290) has the molecular formula C9H11N5O5P- and a molecular weight of 300.19 g/mol. Its IUPAC name is [(2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]-hydroxy-dioxidophosphanium.
| Compound Name | [(2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]-hydroxy-dioxidophosphanium |
|---|---|
| PubChem CID | 136784290 |
| Molecular Formula | C9H11N5O5P- |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [(2S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]-hydroxy-dioxidophosphanium |
| SMILES | Nc1nc2c(ncn2[C@H]2CO[C@@H]([P+]([O-])([O-])O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N5O5P/c10-9-12-7-6(8(15)13-9)11-3-14(7)4-1-5(19-2-4)20(16,17)18/h3-5H,1-2H2,(H2,16,17,18)(H3,10,12,13,15)/p-1/t4-,5+/m1/s1 |
| InChIKey | HSNAGVYIOMOUMF-UHNVWZDZSA-M |
| XLogP | -2.54 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|