C11H14N5O5P — CID 22211347
[3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-6-yl]phosphonic acid (PubChem CID 22211347) has the molecular formula C11H14N5O5P and a molecular weight of 327.24 g/mol. Its IUPAC name is [3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-6-yl]phosphonic acid.
| Compound Name | [3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-6-yl]phosphonic acid |
|---|---|
| PubChem CID | 22211347 |
| Molecular Formula | C11H14N5O5P |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | [3-(6-aminopurin-9-yl)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-6-yl]phosphonic acid |
| SMILES | Nc1ncnc2c1ncn2C1CC=C(P(=O)(O)O)OC1CO |
| InChI | InChI=1S/C11H14N5O5P/c12-10-9-11(14-4-13-10)16(5-15-9)6-1-2-8(22(18,19)20)21-7(6)3-17/h2,4-7,17H,1,3H2,(H2,12,13,14)(H2,18,19,20) |
| InChIKey | NZNVUYLNGGBIAL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|