C11H17N7O2 — CID 174798774
(6-aminopurin-9-yl) (2S)-2,6-diaminohexanoate (PubChem CID 174798774) has the molecular formula C11H17N7O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is (6-aminopurin-9-yl) (2S)-2,6-diaminohexanoate.
| Compound Name | (6-aminopurin-9-yl) (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 174798774 |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (6-aminopurin-9-yl) (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)On1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H17N7O2/c12-4-2-1-3-7(13)11(19)20-18-6-17-8-9(14)15-5-16-10(8)18/h5-7H,1-4,12-13H2,(H2,14,15,16)/t7-/m0/s1 |
| InChIKey | UJWUVXAPQUTXLA-ZETCQYMHSA-N |
| XLogP | -1.18 |
| TPSA | 147.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|