C21H34N8O3 — CID 110154151
(2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxy-4-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]hexan-1-one (PubChem CID 110154151) has the molecular formula C21H34N8O3 and a molecular weight of 446.56 g/mol. Its IUPAC name is (2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxy-4-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]hexan-1-one.
| Compound Name | (2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxy-4-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]hexan-1-one |
|---|---|
| PubChem CID | 110154151 |
| Molecular Formula | C21H34N8O3 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | (2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxy-4-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]hexan-1-one |
| SMILES | C[C@]1(O)CC2(CCN(C(=O)[C@H](N)CCCCN)CC2)OC[C@@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H34N8O3/c1-20(31)11-21(5-8-28(9-6-21)19(30)14(23)4-2-3-7-22)32-10-15(20)29-13-27-16-17(24)25-12-26-18(16)29/h12-15,31H,2-11,22-23H2,1H3,(H2,24,25,26)/t14-,15+,20+/m1/s1 |
| InChIKey | WWWRTVAVANHCQC-SIFCLUCFSA-N |
| XLogP | -0.06 |
| TPSA | 171.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|