C23H36N8O4 — CID 110154471
N-[(5S)-5-amino-6-[(3R,4S)-4-(6-aminopurin-9-yl)-3-hydroxy-3-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]-6-oxohexyl]acetamide (PubChem CID 110154471) has the molecular formula C23H36N8O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-[(3R,4S)-4-(6-aminopurin-9-yl)-3-hydroxy-3-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]-6-oxohexyl]acetamide.
| Compound Name | N-[(5S)-5-amino-6-[(3R,4S)-4-(6-aminopurin-9-yl)-3-hydroxy-3-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 110154471 |
| Molecular Formula | C23H36N8O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | N-[(5S)-5-amino-6-[(3R,4S)-4-(6-aminopurin-9-yl)-3-hydroxy-3-methyl-1-oxa-9-azaspiro[5.5]undecan-9-yl]-6-oxohexyl]acetamide |
| SMILES | CC(=O)NCCCC[C@H](N)C(=O)N1CCC2(CC1)C[C@H](n1cnc3c(N)ncnc31)[C@@](C)(O)CO2 |
| InChI | InChI=1S/C23H36N8O4/c1-15(32)26-8-4-3-5-16(24)21(33)30-9-6-23(7-10-30)11-17(22(2,34)12-35-23)31-14-29-18-19(25)27-13-28-20(18)31/h13-14,16-17,34H,3-12,24H2,1-2H3,(H,26,32)(H2,25,27,28)/t16-,17-,22-/m0/s1 |
| InChIKey | DPMDOHRFRZPCRO-HOIFWPIMSA-N |
| XLogP | 0.12 |
| TPSA | 174.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|