C22H36ClN7O6 — CID 171699961
N-[(5S)-5-amino-6-[(3S,4S,6R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-4,6-dihydroxy-4-methylazepan-1-yl]-6-oxohexyl]acetamide;hydrochloride (PubChem CID 171699961) has the molecular formula C22H36ClN7O6 and a molecular weight of 530.03 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-[(3S,4S,6R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-4,6-dihydroxy-4-methylazepan-1-yl]-6-oxohexyl]acetamide;hydrochloride.
| Compound Name | N-[(5S)-5-amino-6-[(3S,4S,6R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-4,6-dihydroxy-4-methylazepan-1-yl]-6-oxohexyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 171699961 |
| Molecular Formula | C22H36ClN7O6 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[(5S)-5-amino-6-[(3S,4S,6R)-3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-4,6-dihydroxy-4-methylazepan-1-yl]-6-oxohexyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCCCC[C@H](N)C(=O)N1C[C@H](O)C[C@](C)(O)[C@@H](n2cnc3c2c(=O)n(C)c(=O)n3C)C1.Cl |
| InChI | InChI=1S/C22H35N7O6.ClH/c1-13(30)24-8-6-5-7-15(23)19(32)28-10-14(31)9-22(2,35)16(11-28)29-12-25-18-17(29)20(33)27(4)21(34)26(18)3;/h12,14-16,31,35H,5-11,23H2,1-4H3,(H,24,30);1H/t14-,15+,16+,22+;/m1./s1 |
| InChIKey | ZWQGIIJVPRODQW-UULURHHSSA-N |
| XLogP | -1.63 |
| TPSA | 177.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|