C22H29ClN6O5 — CID 171687690
7-[(3S,4S,6R)-1-[4-(aminomethyl)benzoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione;hydrochloride (PubChem CID 171687690) has the molecular formula C22H29ClN6O5 and a molecular weight of 492.96 g/mol. Its IUPAC name is 7-[(3S,4S,6R)-1-[4-(aminomethyl)benzoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 7-[(3S,4S,6R)-1-[4-(aminomethyl)benzoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 171687690 |
| Molecular Formula | C22H29ClN6O5 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 7-[(3S,4S,6R)-1-[4-(aminomethyl)benzoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(ncn2[C@H]2CN(C(=O)c3ccc(CN)cc3)C[C@H](O)C[C@]2(C)O)n(C)c1=O |
| InChI | InChI=1S/C22H28N6O5.ClH/c1-22(33)8-15(29)10-27(19(30)14-6-4-13(9-23)5-7-14)11-16(22)28-12-24-18-17(28)20(31)26(3)21(32)25(18)2;/h4-7,12,15-16,29,33H,8-11,23H2,1-3H3;1H/t15-,16+,22+;/m1./s1 |
| InChIKey | PZRSMVMZPDOMGE-QJMBPBJNSA-N |
| XLogP | -0.49 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |